C19H30NO2+ — CID 5260368
[3-[2-(2-bicyclo[2.2.1]heptanyl)phenoxy]-2-hydroxypropyl]-propan-2-ylazanium (PubChem CID 5260368) has the molecular formula C19H30NO2+ and a molecular weight of 304.45 g/mol. Its IUPAC name is [3-[2-(2-bicyclo[2.2.1]heptanyl)phenoxy]-2-hydroxypropyl]-propan-2-ylazanium.
| Compound Name | [3-[2-(2-bicyclo[2.2.1]heptanyl)phenoxy]-2-hydroxypropyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 5260368 |
| Molecular Formula | C19H30NO2+ |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | [3-[2-(2-bicyclo[2.2.1]heptanyl)phenoxy]-2-hydroxypropyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]CC(O)COc1ccccc1C1CC2CCC1C2 |
| InChI | InChI=1S/C19H29NO2/c1-13(2)20-11-16(21)12-22-19-6-4-3-5-17(19)18-10-14-7-8-15(18)9-14/h3-6,13-16,18,20-21H,7-12H2,1-2H3/p+1 |
| InChIKey | NACJSVRGPPMZRS-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |