C19H16N2O4S2 — CID 5263920
2-(3-nitrophenyl)sulfonyl-1-thiophen-3-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 5263920) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(3-nitrophenyl)sulfonyl-1-thiophen-3-yl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3-nitrophenyl)sulfonyl-1-thiophen-3-yl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 5263920 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-(3-nitrophenyl)sulfonyl-1-thiophen-3-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCc3ccccc3C2c2ccsc2)c1 |
| InChI | InChI=1S/C19H16N2O4S2/c22-21(23)16-5-3-6-17(12-16)27(24,25)20-10-8-14-4-1-2-7-18(14)19(20)15-9-11-26-13-15/h1-7,9,11-13,19H,8,10H2 |
| InChIKey | OSUUSPOWCCEUJP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|