C17H14N4O4S2 — CID 5263958
3-[2-(4-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-1,2,5-thiadiazole (PubChem CID 5263958) has the molecular formula C17H14N4O4S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-[2-(4-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-1,2,5-thiadiazole.
| Compound Name | 3-[2-(4-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 5263958 |
| Molecular Formula | C17H14N4O4S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 3-[2-(4-nitrophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-1,2,5-thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCc3ccccc3C2c2cnsn2)cc1 |
| InChI | InChI=1S/C17H14N4O4S2/c22-21(23)13-5-7-14(8-6-13)27(24,25)20-10-9-12-3-1-2-4-15(12)17(20)16-11-18-26-19-16/h1-8,11,17H,9-10H2 |
| InChIKey | CVNQHPFLBYZTIT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|