C26H28O4 — CID 5264522
[3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-6-yl] 3-cyclopentylpropanoate (PubChem CID 5264522) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is [3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-6-yl] 3-cyclopentylpropanoate.
| Compound Name | [3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-6-yl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 5264522 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1-benzofuran-6-yl] 3-cyclopentylpropanoate |
| SMILES | CC(C)c1ccc(C=C2Oc3cc(OC(=O)CCC4CCCC4)ccc3C2=O)cc1 |
| InChI | InChI=1S/C26H28O4/c1-17(2)20-10-7-19(8-11-20)15-24-26(28)22-13-12-21(16-23(22)30-24)29-25(27)14-9-18-5-3-4-6-18/h7-8,10-13,15-18H,3-6,9,14H2,1-2H3 |
| InChIKey | GHOXRXWSFAJCRJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|