C33H29N5O2S2 — CID 5269244
5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-prop-2-enoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 5269244) has the molecular formula C33H29N5O2S2 and a molecular weight of 591.76 g/mol. Its IUPAC name is 5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-prop-2-enoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-prop-2-enoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 5269244 |
| Molecular Formula | C33H29N5O2S2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-prop-2-enoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | C=CCOc1ccc(-c2nc3sc(=Cc4cn(-c5ccccc5)nc4-c4ccc(SCCCC)cc4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C33H29N5O2S2/c1-3-5-20-41-28-17-13-23(14-18-28)30-25(22-37(35-30)26-9-7-6-8-10-26)21-29-32(39)38-33(42-29)34-31(36-38)24-11-15-27(16-12-24)40-19-4-2/h4,6-18,21-22H,2-3,5,19-20H2,1H3 |
| InChIKey | LFKWXGOKNSOKKZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|