C23H19ClN2O4S — CID 52702742
4-chloro-N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-3-methylsulfonylbenzamide (PubChem CID 52702742) has the molecular formula C23H19ClN2O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is 4-chloro-N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 52702742 |
| Molecular Formula | C23H19ClN2O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 4-chloro-N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)Nc2ccccc2COc2ccc(CC#N)cc2)ccc1Cl |
| InChI | InChI=1S/C23H19ClN2O4S/c1-31(28,29)22-14-17(8-11-20(22)24)23(27)26-21-5-3-2-4-18(21)15-30-19-9-6-16(7-10-19)12-13-25/h2-11,14H,12,15H2,1H3,(H,26,27) |
| InChIKey | SVLNBXQQLSAYGR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |