C22H20N2O3 — CID 55899603
N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-5-ethylfuran-2-carboxamide (PubChem CID 55899603) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-5-ethylfuran-2-carboxamide.
| Compound Name | N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-5-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55899603 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[2-[[4-(cyanomethyl)phenoxy]methyl]phenyl]-5-ethylfuran-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccccc2COc2ccc(CC#N)cc2)o1 |
| InChI | InChI=1S/C22H20N2O3/c1-2-18-11-12-21(27-18)22(25)24-20-6-4-3-5-17(20)15-26-19-9-7-16(8-10-19)13-14-23/h3-12H,2,13,15H2,1H3,(H,24,25) |
| InChIKey | DKXMIXPVZYIAKU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |