C22H21BrN2O4 — CID 55778335
N-[2-[[acetyl(methyl)amino]methyl]phenyl]-5-[(4-bromophenoxy)methyl]furan-2-carboxamide (PubChem CID 55778335) has the molecular formula C22H21BrN2O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is N-[2-[[acetyl(methyl)amino]methyl]phenyl]-5-[(4-bromophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[2-[[acetyl(methyl)amino]methyl]phenyl]-5-[(4-bromophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55778335 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[2-[[acetyl(methyl)amino]methyl]phenyl]-5-[(4-bromophenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(=O)N(C)Cc1ccccc1NC(=O)c1ccc(COc2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C22H21BrN2O4/c1-15(26)25(2)13-16-5-3-4-6-20(16)24-22(27)21-12-11-19(29-21)14-28-18-9-7-17(23)8-10-18/h3-12H,13-14H2,1-2H3,(H,24,27) |
| InChIKey | HICXAZCUIWBCOI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |