C21H23N3O4 — CID 5271081
ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-quinolin-2-ylprop-2-enoyl]amino]hept-2-enoate (PubChem CID 5271081) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-quinolin-2-ylprop-2-enoyl]amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-quinolin-2-ylprop-2-enoyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 5271081 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethyl (E,4S)-7-amino-7-oxo-4-[[(E)-3-quinolin-2-ylprop-2-enoyl]amino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)/C=C/c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H23N3O4/c1-2-28-21(27)14-11-17(9-12-19(22)25)24-20(26)13-10-16-8-7-15-5-3-4-6-18(15)23-16/h3-8,10-11,13-14,17H,2,9,12H2,1H3,(H2,22,25)(H,24,26)/b13-10+,14-11+/t17-/m0/s1 |
| InChIKey | ISEDILGHAMOPPC-ZEZSUXETSA-N |
| XLogP | 2.12 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|