C16H17FN2O2 — CID 52714970
4-(3-fluorophenoxy)-N-(4-methyl-2-pyridinyl)butanamide (PubChem CID 52714970) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-N-(4-methyl-2-pyridinyl)butanamide.
| Compound Name | 4-(3-fluorophenoxy)-N-(4-methyl-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 52714970 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-(3-fluorophenoxy)-N-(4-methyl-2-pyridinyl)butanamide |
| SMILES | Cc1ccnc(NC(=O)CCCOc2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H17FN2O2/c1-12-7-8-18-15(10-12)19-16(20)6-3-9-21-14-5-2-4-13(17)11-14/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,18,19,20) |
| InChIKey | IVHXJMIILFFOJZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|