C13H19NO8 — CID 5273684
[(E,2R,3R)-2,3-diacetyloxy-7-nitrohept-4-enyl] acetate (PubChem CID 5273684) has the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. Its IUPAC name is [(E,2R,3R)-2,3-diacetyloxy-7-nitrohept-4-enyl] acetate.
| Compound Name | [(E,2R,3R)-2,3-diacetyloxy-7-nitrohept-4-enyl] acetate |
|---|---|
| PubChem CID | 5273684 |
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(E,2R,3R)-2,3-diacetyloxy-7-nitrohept-4-enyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](/C=C/CC[N+](=O)[O-])OC(C)=O |
| InChI | InChI=1S/C13H19NO8/c1-9(15)20-8-13(22-11(3)17)12(21-10(2)16)6-4-5-7-14(18)19/h4,6,12-13H,5,7-8H2,1-3H3/b6-4+/t12-,13-/m1/s1 |
| InChIKey | HWOTWNLJQLPXRH-LOWFTVKWSA-N |
| XLogP | 0.64 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|