C26H33FN2O8S — CID 5278522
[(R)-(2-fluorophenyl)-[(2S,6S)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-6-(2-methylpropyl)-3,5-dioxopiperazin-2-yl]methyl] methanesulfonate (PubChem CID 5278522) has the molecular formula C26H33FN2O8S and a molecular weight of 552.62 g/mol. Its IUPAC name is [(R)-(2-fluorophenyl)-[(2S,6S)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-6-(2-methylpropyl)-3,5-dioxopiperazin-2-yl]methyl] methanesulfonate.
| Compound Name | [(R)-(2-fluorophenyl)-[(2S,6S)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-6-(2-methylpropyl)-3,5-dioxopiperazin-2-yl]methyl] methanesulfonate |
|---|---|
| PubChem CID | 5278522 |
| Molecular Formula | C26H33FN2O8S |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | [(R)-(2-fluorophenyl)-[(2S,6S)-4-(methoxymethoxy)-1-[(4-methoxyphenyl)methyl]-6-(2-methylpropyl)-3,5-dioxopiperazin-2-yl]methyl] methanesulfonate |
| SMILES | COCON1C(=O)[C@H]([C@H](OS(C)(=O)=O)c2ccccc2F)N(Cc2ccc(OC)cc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C26H33FN2O8S/c1-17(2)14-22-25(30)29(36-16-34-3)26(31)23(28(22)15-18-10-12-19(35-4)13-11-18)24(37-38(5,32)33)20-8-6-7-9-21(20)27/h6-13,17,22-24H,14-16H2,1-5H3/t22-,23-,24+/m0/s1 |
| InChIKey | NRFXLGCBUFUZAL-KMDXXIMOSA-N |
| XLogP | 3.04 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|