C28H29FN2O6 — CID 5278514
(3S,5S)-3-benzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione (PubChem CID 5278514) has the molecular formula C28H29FN2O6 and a molecular weight of 508.55 g/mol. Its IUPAC name is (3S,5S)-3-benzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione.
| Compound Name | (3S,5S)-3-benzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 5278514 |
| Molecular Formula | C28H29FN2O6 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (3S,5S)-3-benzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]piperazine-2,6-dione |
| SMILES | COCON1C(=O)[C@H]([C@H](O)c2ccc(F)cc2)N(Cc2ccc(OC)cc2)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H29FN2O6/c1-35-18-37-31-27(33)24(16-19-6-4-3-5-7-19)30(17-20-8-14-23(36-2)15-9-20)25(28(31)34)26(32)21-10-12-22(29)13-11-21/h3-15,24-26,32H,16-18H2,1-2H3/t24-,25-,26+/m0/s1 |
| InChIKey | LCSTYFCMAMKKNK-KKUQBAQOSA-N |
| XLogP | 3.25 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|