C25H31FN2O6 — CID 5278511
(3S,5S)-3-[(R)-(2-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione (PubChem CID 5278511) has the molecular formula C25H31FN2O6 and a molecular weight of 474.53 g/mol. Its IUPAC name is (3S,5S)-3-[(R)-(2-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione.
| Compound Name | (3S,5S)-3-[(R)-(2-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 5278511 |
| Molecular Formula | C25H31FN2O6 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (3S,5S)-3-[(R)-(2-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione |
| SMILES | COCON1C(=O)[C@H]([C@H](O)c2ccccc2F)N(Cc2ccc(OC)cc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C25H31FN2O6/c1-16(2)13-21-24(30)28(34-15-32-3)25(31)22(23(29)19-7-5-6-8-20(19)26)27(21)14-17-9-11-18(33-4)12-10-17/h5-12,16,21-23,29H,13-15H2,1-4H3/t21-,22-,23+/m0/s1 |
| InChIKey | NIUHCRLQNVEBTI-RJGXRXQPSA-N |
| XLogP | 3.06 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|