C26H34N2O7 — CID 5278508
(3S,5S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione (PubChem CID 5278508) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is (3S,5S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione.
| Compound Name | (3S,5S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 5278508 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (3S,5S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]-1-(methoxymethoxy)-4-[(4-methoxyphenyl)methyl]-5-(2-methylpropyl)piperazine-2,6-dione |
| SMILES | COCON1C(=O)[C@H]([C@H](O)c2ccc(OC)cc2)N(Cc2ccc(OC)cc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C26H34N2O7/c1-17(2)14-22-25(30)28(35-16-32-3)26(31)23(24(29)19-8-12-21(34-5)13-9-19)27(22)15-18-6-10-20(33-4)11-7-18/h6-13,17,22-24,29H,14-16H2,1-5H3/t22-,23-,24+/m0/s1 |
| InChIKey | CDESRMNXLKKZMW-KMDXXIMOSA-N |
| XLogP | 2.93 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|