C16H11BrN2O4S2 — CID 52813401
(2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-4-sulfonate (PubChem CID 52813401) has the molecular formula C16H11BrN2O4S2 and a molecular weight of 439.31 g/mol. Its IUPAC name is (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-4-sulfonate.
| Compound Name | (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-4-sulfonate |
|---|---|
| PubChem CID | 52813401 |
| Molecular Formula | C16H11BrN2O4S2 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | (2-carbamoylphenyl) 2-(4-bromophenyl)-1,3-thiazole-4-sulfonate |
| SMILES | NC(=O)c1ccccc1OS(=O)(=O)c1csc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C16H11BrN2O4S2/c17-11-7-5-10(6-8-11)16-19-14(9-24-16)25(21,22)23-13-4-2-1-3-12(13)15(18)20/h1-9H,(H2,18,20) |
| InChIKey | KTSGRPNRDLAERG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|