C19H21BrN2O4 — CID 52815228
5-bromo-N-[(2-butoxy-3-pyridinyl)methyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide (PubChem CID 52815228) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is 5-bromo-N-[(2-butoxy-3-pyridinyl)methyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide.
| Compound Name | 5-bromo-N-[(2-butoxy-3-pyridinyl)methyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
|---|---|
| PubChem CID | 52815228 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 5-bromo-N-[(2-butoxy-3-pyridinyl)methyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
| SMILES | CCCCOc1ncccc1CNC(=O)c1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C19H21BrN2O4/c1-2-3-7-26-19-13(5-4-6-21-19)12-22-18(23)14-10-15(20)17-16(11-14)24-8-9-25-17/h4-6,10-11H,2-3,7-9,12H2,1H3,(H,22,23) |
| InChIKey | VQDVHTVJTVLOBL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|