C25H23N3O2 — CID 52841319
14-[(2S)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one (PubChem CID 52841319) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 14-[(2S)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one.
| Compound Name | 14-[(2S)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 52841319 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 14-[(2S)-3-[benzyl(methyl)amino]-2-hydroxypropyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| SMILES | CN(Cc1ccccc1)C[C@H](O)Cn1nc2c3c(cccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H23N3O2/c1-27(14-17-8-3-2-4-9-17)15-18(29)16-28-22-13-7-12-21-23(22)24(26-28)19-10-5-6-11-20(19)25(21)30/h2-13,18,29H,14-16H2,1H3/t18-/m0/s1 |
| InChIKey | OOVUAJUBANHHPC-SFHVURJKSA-N |
| XLogP | 3.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |