About 2,4-dimethoxyaniline;hydrochloride
2,4-dimethoxyaniline;hydrochloride (PubChem CID 5284385) has the molecular formula C8H12ClNO2
and a molecular weight of 189.64 g/mol. Its IUPAC name is 2,4-dimethoxyaniline;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dimethoxyaniline;hydrochloride |
| PubChem CID | 5284385 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2,4-dimethoxyaniline;hydrochloride |
| SMILES | COc1ccc(N)c(OC)c1.Cl |
| InChI | InChI=1S/C8H11NO2.ClH/c1-10-6-3-4-7(9)8(5-6)11-2;/h3-5H,9H2,1-2H3;1H |
| InChIKey | PFHRGNBFRBWOPD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethoxyaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxyaniline;hydrochloride?
The IUPAC name of 2,4-dimethoxyaniline;hydrochloride (CID 5284385) is 2,4-dimethoxyaniline;hydrochloride.
What is the SMILES notation for 2,4-dimethoxyaniline;hydrochloride?
The canonical SMILES for 2,4-dimethoxyaniline;hydrochloride is COc1ccc(N)c(OC)c1.Cl.
What is the InChIKey of 2,4-dimethoxyaniline;hydrochloride?
The InChIKey is PFHRGNBFRBWOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.ClH/c1-10-6-3-4-7(9)8(5-6)11-2;/h3-5H,9H2,1-2H3;1H.
What are the key properties of 2,4-dimethoxyaniline;hydrochloride?
2,4-dimethoxyaniline;hydrochloride has a molecular weight of 189.64 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxyaniline;hydrochloride is sourced from PubChem (CID 5284385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).