C27H32N4O9S — CID 5287526
2-[2-[(E)-3-amino-3-oxoprop-1-enyl]-4-[(2S)-2-(methanesulfonamido)-3-oxo-3-(pentylamino)propyl]-N-oxaloanilino]benzoic acid (PubChem CID 5287526) has the molecular formula C27H32N4O9S and a molecular weight of 588.64 g/mol. Its IUPAC name is 2-[2-[(E)-3-amino-3-oxoprop-1-enyl]-4-[(2S)-2-(methanesulfonamido)-3-oxo-3-(pentylamino)propyl]-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[2-[(E)-3-amino-3-oxoprop-1-enyl]-4-[(2S)-2-(methanesulfonamido)-3-oxo-3-(pentylamino)propyl]-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 5287526 |
| Molecular Formula | C27H32N4O9S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 2-[2-[(E)-3-amino-3-oxoprop-1-enyl]-4-[(2S)-2-(methanesulfonamido)-3-oxo-3-(pentylamino)propyl]-N-oxaloanilino]benzoic acid |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(N(C(=O)C(=O)O)c2ccccc2C(=O)O)c(/C=C/C(N)=O)c1)NS(C)(=O)=O |
| InChI | InChI=1S/C27H32N4O9S/c1-3-4-7-14-29-24(33)20(30-41(2,39)40)16-17-10-12-21(18(15-17)11-13-23(28)32)31(25(34)27(37)38)22-9-6-5-8-19(22)26(35)36/h5-6,8-13,15,20,30H,3-4,7,14,16H2,1-2H3,(H2,28,32)(H,29,33)(H,35,36)(H,37,38)/b13-11+/t20-/m0/s1 |
| InChIKey | FSRCMOQVSVRBJH-RPAADVPWSA-N |
| XLogP | 1.40 |
| TPSA | 213.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|