C21H20N2O3 — CID 52882982
ethyl (3Z,5E)-4-oxo-3,5-bis(pyridin-3-ylmethylidene)cyclohexane-1-carboxylate (PubChem CID 52882982) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl (3Z,5E)-4-oxo-3,5-bis(pyridin-3-ylmethylidene)cyclohexane-1-carboxylate.
| Compound Name | ethyl (3Z,5E)-4-oxo-3,5-bis(pyridin-3-ylmethylidene)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 52882982 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | ethyl (3Z,5E)-4-oxo-3,5-bis(pyridin-3-ylmethylidene)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1C/C(=C/c2cccnc2)C(=O)/C(=C/c2cccnc2)C1 |
| InChI | InChI=1S/C21H20N2O3/c1-2-26-21(25)19-11-17(9-15-5-3-7-22-13-15)20(24)18(12-19)10-16-6-4-8-23-14-16/h3-10,13-14,19H,2,11-12H2,1H3/b17-9-,18-10+ |
| InChIKey | SNZQDTKYMUWVRI-BUOZRGFLSA-N |
| XLogP | 3.49 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|