C20H17N5O3S — CID 52887226
2-[(4-methylphenoxy)methyl]-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-1,3-thiazole (PubChem CID 52887226) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 2-[(4-methylphenoxy)methyl]-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[(4-methylphenoxy)methyl]-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 52887226 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[(4-methylphenoxy)methyl]-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1ccc(OCc2nc(Cn3cnc(-c4cccc([N+](=O)[O-])c4)n3)cs2)cc1 |
| InChI | InChI=1S/C20H17N5O3S/c1-14-5-7-18(8-6-14)28-11-19-22-16(12-29-19)10-24-13-21-20(23-24)15-3-2-4-17(9-15)25(26)27/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | OMQVTRMABSXJNC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|