C13H8Cl2F4O5 — CID 528912
[4-[2,2-bis[chloro(difluoro)methyl]-5-oxo-1,3-dioxolan-4-yl]phenyl] acetate (PubChem CID 528912) has the molecular formula C13H8Cl2F4O5 and a molecular weight of 391.10 g/mol. Its IUPAC name is [4-[2,2-bis[chloro(difluoro)methyl]-5-oxo-1,3-dioxolan-4-yl]phenyl] acetate.
| Compound Name | [4-[2,2-bis[chloro(difluoro)methyl]-5-oxo-1,3-dioxolan-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 528912 |
| Molecular Formula | C13H8Cl2F4O5 |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | [4-[2,2-bis[chloro(difluoro)methyl]-5-oxo-1,3-dioxolan-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2OC(C(F)(F)Cl)(C(F)(F)Cl)OC2=O)cc1 |
| InChI | InChI=1S/C13H8Cl2F4O5/c1-6(20)22-8-4-2-7(3-5-8)9-10(21)24-11(23-9,12(14,16)17)13(15,18)19/h2-5,9H,1H3 |
| InChIKey | ARVRVILNVYPGQC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|