C5H8FO5- — CID 5289591
(3R,4R,5S,6R)-6-fluoro-3,4,5-trihydroxyoxan-2-olate (PubChem CID 5289591) has the molecular formula C5H8FO5- and a molecular weight of 167.11 g/mol. Its IUPAC name is (3R,4R,5S,6R)-6-fluoro-3,4,5-trihydroxyoxan-2-olate.
| Compound Name | (3R,4R,5S,6R)-6-fluoro-3,4,5-trihydroxyoxan-2-olate |
|---|---|
| PubChem CID | 5289591 |
| Molecular Formula | C5H8FO5- |
| Molecular Weight | 167.11 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | (3R,4R,5S,6R)-6-fluoro-3,4,5-trihydroxyoxan-2-olate |
| SMILES | [O-]C1O[C@H](F)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C5H8FO5/c6-4-2(8)1(7)3(9)5(10)11-4/h1-5,7-9H/q-1/t1-,2-,3+,4-,5?/m0/s1 |
| InChIKey | CSWSGZBYLQUXQI-ZAMRNKCBSA-N |
| XLogP | -2.92 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.11 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |