C6H9O6- — CID 23360996
6-formyl-3,4,5-trihydroxyoxan-2-olate (PubChem CID 23360996) has the molecular formula C6H9O6- and a molecular weight of 177.13 g/mol. Its IUPAC name is 6-formyl-3,4,5-trihydroxyoxan-2-olate.
| Compound Name | 6-formyl-3,4,5-trihydroxyoxan-2-olate |
|---|---|
| PubChem CID | 23360996 |
| Molecular Formula | C6H9O6- |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 6-formyl-3,4,5-trihydroxyoxan-2-olate |
| SMILES | O=CC1OC([O-])C(O)C(O)C1O |
| InChI | InChI=1S/C6H9O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h1-6,8-10H/q-1 |
| InChIKey | WTQMIMZVLQZNNZ-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|