C6H11NO5 — CID 126510613
4-amino-3,5,6-trihydroxyoxane-2-carbaldehyde (PubChem CID 126510613) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-amino-3,5,6-trihydroxyoxane-2-carbaldehyde.
| Compound Name | 4-amino-3,5,6-trihydroxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 126510613 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 4-amino-3,5,6-trihydroxyoxane-2-carbaldehyde |
| SMILES | NC1C(O)C(O)OC(C=O)C1O |
| InChI | InChI=1S/C6H11NO5/c7-3-4(9)2(1-8)12-6(11)5(3)10/h1-6,9-11H,7H2 |
| InChIKey | UBUGLIHOZGJFQA-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|