C10H9F2N5OS — CID 52896191
N-[2-(difluoromethylsulfanyl)phenyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 52896191) has the molecular formula C10H9F2N5OS and a molecular weight of 285.28 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 52896191 |
| Molecular Formula | C10H9F2N5OS |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C10H9F2N5OS/c11-10(12)19-8-4-2-1-3-7(8)14-9(18)5-17-6-13-15-16-17/h1-4,6,10H,5H2,(H,14,18) |
| InChIKey | ILFGOGLGYUGVFP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |