C12H12F2N4OS — CID 62102362
2-(3-aminopyrazol-1-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 62102362) has the molecular formula C12H12F2N4OS and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 62102362 |
| Molecular Formula | C12H12F2N4OS |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | Nc1ccn(CC(=O)Nc2ccccc2SC(F)F)n1 |
| InChI | InChI=1S/C12H12F2N4OS/c13-12(14)20-9-4-2-1-3-8(9)16-11(19)7-18-6-5-10(15)17-18/h1-6,12H,7H2,(H2,15,17)(H,16,19) |
| InChIKey | AAXRCMPPWXSRET-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |