C23H25BrN4O3 — CID 52909375
1-[4-[[(3S)-1-(3-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]piperidine-4-carboxamide (PubChem CID 52909375) has the molecular formula C23H25BrN4O3 and a molecular weight of 485.38 g/mol. Its IUPAC name is 1-[4-[[(3S)-1-(3-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[(3S)-1-(3-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 52909375 |
| Molecular Formula | C23H25BrN4O3 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 1-[4-[[(3S)-1-(3-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(NC(=O)[C@H]3CC(=O)N(c4cccc(Br)c4)C3)cc2)CC1 |
| InChI | InChI=1S/C23H25BrN4O3/c24-17-2-1-3-20(13-17)28-14-16(12-21(28)29)23(31)26-18-4-6-19(7-5-18)27-10-8-15(9-11-27)22(25)30/h1-7,13,15-16H,8-12,14H2,(H2,25,30)(H,26,31)/t16-/m0/s1 |
| InChIKey | WQECUSYPKFTMLD-INIZCTEOSA-N |
| XLogP | 3.14 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|