C19H28O7 — CID 52916564
(E)-3-[(4R,5R)-5-[(2R)-3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-methoxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enal (PubChem CID 52916564) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is (E)-3-[(4R,5R)-5-[(2R)-3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-methoxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enal.
| Compound Name | (E)-3-[(4R,5R)-5-[(2R)-3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-methoxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enal |
|---|---|
| PubChem CID | 52916564 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (E)-3-[(4R,5R)-5-[(2R)-3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-methoxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylprop-2-enal |
| SMILES | CO[C@@H](CC1=CC(=O)OC(C)(C)O1)C[C@H]1OC(C)(C)O[C@@H]1/C=C(\C)C=O |
| InChI | InChI=1S/C19H28O7/c1-12(11-20)7-15-16(25-19(4,5)24-15)9-13(22-6)8-14-10-17(21)26-18(2,3)23-14/h7,10-11,13,15-16H,8-9H2,1-6H3/b12-7+/t13-,15+,16+/m0/s1 |
| InChIKey | XOLNRKTTXNJUAJ-LDPZUGJDSA-N |
| XLogP | 2.64 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|