C17H15I4N3O3 — CID 52919194
2-[4-[4-[2-(diaminomethylideneamino)ethyl]-3,5-diiodophenoxy]-3,5-diiodophenyl]acetic acid (PubChem CID 52919194) has the molecular formula C17H15I4N3O3 and a molecular weight of 816.94 g/mol. Its IUPAC name is 2-[4-[4-[2-(diaminomethylideneamino)ethyl]-3,5-diiodophenoxy]-3,5-diiodophenyl]acetic acid.
| Compound Name | 2-[4-[4-[2-(diaminomethylideneamino)ethyl]-3,5-diiodophenoxy]-3,5-diiodophenyl]acetic acid |
|---|---|
| PubChem CID | 52919194 |
| Molecular Formula | C17H15I4N3O3 |
| Molecular Weight | 816.94 g/mol |
| Exact Mass | 816.73 |
| IUPAC Name | 2-[4-[4-[2-(diaminomethylideneamino)ethyl]-3,5-diiodophenoxy]-3,5-diiodophenyl]acetic acid |
| SMILES | NC(N)=NCCc1c(I)cc(Oc2c(I)cc(CC(=O)O)cc2I)cc1I |
| InChI | InChI=1S/C17H15I4N3O3/c18-11-6-9(7-12(19)10(11)1-2-24-17(22)23)27-16-13(20)3-8(4-14(16)21)5-15(25)26/h3-4,6-7H,1-2,5H2,(H,25,26)(H4,22,23,24) |
| InChIKey | HHUCSSCKVSHGHL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.94 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|