C16H14I2O4 — CID 71113040
2-[4-(4-hydroxy-3-iodo-5-methylphenoxy)-3-iodo-5-methylphenyl]acetic acid (PubChem CID 71113040) has the molecular formula C16H14I2O4 and a molecular weight of 524.09 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-3-iodo-5-methylphenoxy)-3-iodo-5-methylphenyl]acetic acid.
| Compound Name | 2-[4-(4-hydroxy-3-iodo-5-methylphenoxy)-3-iodo-5-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 71113040 |
| Molecular Formula | C16H14I2O4 |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.90 |
| IUPAC Name | 2-[4-(4-hydroxy-3-iodo-5-methylphenoxy)-3-iodo-5-methylphenyl]acetic acid |
| SMILES | Cc1cc(Oc2c(C)cc(CC(=O)O)cc2I)cc(I)c1O |
| InChI | InChI=1S/C16H14I2O4/c1-8-4-11(7-12(17)15(8)21)22-16-9(2)3-10(5-13(16)18)6-14(19)20/h3-5,7,21H,6H2,1-2H3,(H,19,20) |
| InChIKey | UCKIGZFSAWKOBJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|