C17H12Cl3NO3 — CID 52920629
2-[4-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]phenoxy]acetamide (PubChem CID 52920629) has the molecular formula C17H12Cl3NO3 and a molecular weight of 384.65 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 52920629 |
| Molecular Formula | C17H12Cl3NO3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 2-[4-[(E)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(C(=O)/C=C/c2c(Cl)ccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H12Cl3NO3/c18-13-6-7-14(19)17(20)12(13)5-8-15(22)10-1-3-11(4-2-10)24-9-16(21)23/h1-8H,9H2,(H2,21,23)/b8-5+ |
| InChIKey | SSFHEUXKECUIIM-VMPITWQZSA-N |
| XLogP | 4.41 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|