C23H18O7 — CID 52937586
4-(3,4-dihydroxyphenyl)-5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-7-hydroxy-3,4-dihydrochromen-2-one (PubChem CID 52937586) has the molecular formula C23H18O7 and a molecular weight of 406.39 g/mol. Its IUPAC name is 4-(3,4-dihydroxyphenyl)-5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-7-hydroxy-3,4-dihydrochromen-2-one.
| Compound Name | 4-(3,4-dihydroxyphenyl)-5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-7-hydroxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 52937586 |
| Molecular Formula | C23H18O7 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-(3,4-dihydroxyphenyl)-5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-7-hydroxy-3,4-dihydrochromen-2-one |
| SMILES | O=C1CC(c2ccc(O)c(O)c2)c2c(/C=C/c3ccc(O)c(O)c3)cc(O)cc2O1 |
| InChI | InChI=1S/C23H18O7/c24-15-8-14(3-1-12-2-5-17(25)19(27)7-12)23-16(11-22(29)30-21(23)10-15)13-4-6-18(26)20(28)9-13/h1-10,16,24-28H,11H2/b3-1+ |
| InChIKey | FZLVIDOBFARVQT-HNQUOIGGSA-N |
| XLogP | 3.83 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|