C24H20O6 — CID 75954573
7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[2-(4-hydroxyphenyl)ethenyl]-3,4-dihydrochromen-2-one (PubChem CID 75954573) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is 7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[2-(4-hydroxyphenyl)ethenyl]-3,4-dihydrochromen-2-one.
| Compound Name | 7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[2-(4-hydroxyphenyl)ethenyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 75954573 |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 7-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[2-(4-hydroxyphenyl)ethenyl]-3,4-dihydrochromen-2-one |
| SMILES | COc1cc(C2CC(=O)Oc3cc(O)cc(C=Cc4ccc(O)cc4)c32)ccc1O |
| InChI | InChI=1S/C24H20O6/c1-29-21-11-15(6-9-20(21)27)19-13-23(28)30-22-12-18(26)10-16(24(19)22)5-2-14-3-7-17(25)8-4-14/h2-12,19,25-27H,13H2,1H3 |
| InChIKey | ZYHGYHJVGNKOFF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|