C19H13N7O2S — CID 52940995
4-N-(1,3-benzothiazol-6-yl)-2-N-(1H-indol-5-yl)-5-nitropyrimidine-2,4-diamine (PubChem CID 52940995) has the molecular formula C19H13N7O2S and a molecular weight of 403.43 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-6-yl)-2-N-(1H-indol-5-yl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-6-yl)-2-N-(1H-indol-5-yl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 52940995 |
| Molecular Formula | C19H13N7O2S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 4-N-(1,3-benzothiazol-6-yl)-2-N-(1H-indol-5-yl)-5-nitropyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccc3[nH]ccc3c2)nc1Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C19H13N7O2S/c27-26(28)16-9-21-19(24-12-1-3-14-11(7-12)5-6-20-14)25-18(16)23-13-2-4-15-17(8-13)29-10-22-15/h1-10,20H,(H2,21,23,24,25) |
| InChIKey | SANYXBNPSCQKPR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|