C17H14F9N3OS — CID 52941425
1,1,1,3,3,3-hexafluoro-2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 52941425) has the molecular formula C17H14F9N3OS and a molecular weight of 479.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 52941425 |
| Molecular Formula | C17H14F9N3OS |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | OC(c1cnc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)s1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H14F9N3OS/c18-15(19,20)10-2-1-3-11(8-10)28-4-6-29(7-5-28)13-27-9-12(31-13)14(30,16(21,22)23)17(24,25)26/h1-3,8-9,30H,4-7H2 |
| InChIKey | COHFQPMMBCEUFR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |