C18H18F6N4O2S — CID 46208235
3-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]-N-methylbenzamide (PubChem CID 46208235) has the molecular formula C18H18F6N4O2S and a molecular weight of 468.42 g/mol. Its IUPAC name is 3-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]-N-methylbenzamide.
| Compound Name | 3-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 46208235 |
| Molecular Formula | C18H18F6N4O2S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-[4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]piperazin-1-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(N2CCN(c3ncc(C(O)(C(F)(F)F)C(F)(F)F)s3)CC2)c1 |
| InChI | InChI=1S/C18H18F6N4O2S/c1-25-14(29)11-3-2-4-12(9-11)27-5-7-28(8-6-27)15-26-10-13(31-15)16(30,17(19,20)21)18(22,23)24/h2-4,9-10,30H,5-8H2,1H3,(H,25,29) |
| InChIKey | DHPARRIJDRPUNH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |