C32H34N4O3 — CID 52941435
N-[3-[2-(diethylamino)ethoxy]-2-[2-(4-methoxy-2-methylphenyl)ethynyl]quinoxalin-6-yl]-4-methylbenzamide (PubChem CID 52941435) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethoxy]-2-[2-(4-methoxy-2-methylphenyl)ethynyl]quinoxalin-6-yl]-4-methylbenzamide.
| Compound Name | N-[3-[2-(diethylamino)ethoxy]-2-[2-(4-methoxy-2-methylphenyl)ethynyl]quinoxalin-6-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 52941435 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-[3-[2-(diethylamino)ethoxy]-2-[2-(4-methoxy-2-methylphenyl)ethynyl]quinoxalin-6-yl]-4-methylbenzamide |
| SMILES | CCN(CC)CCOc1nc2cc(NC(=O)c3ccc(C)cc3)ccc2nc1C#Cc1ccc(OC)cc1C |
| InChI | InChI=1S/C32H34N4O3/c1-6-36(7-2)18-19-39-32-29(16-13-24-12-15-27(38-5)20-23(24)4)34-28-17-14-26(21-30(28)35-32)33-31(37)25-10-8-22(3)9-11-25/h8-12,14-15,17,20-21H,6-7,18-19H2,1-5H3,(H,33,37) |
| InChIKey | OCFCDMYNSCNEJZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|