C26H27N5O3 — CID 52941478
2-[(1-cyclohexyl-3-methyl-4-quinoxalin-6-ylpyrazol-5-yl)amino]-5-methoxybenzoic acid (PubChem CID 52941478) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[(1-cyclohexyl-3-methyl-4-quinoxalin-6-ylpyrazol-5-yl)amino]-5-methoxybenzoic acid.
| Compound Name | 2-[(1-cyclohexyl-3-methyl-4-quinoxalin-6-ylpyrazol-5-yl)amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 52941478 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[(1-cyclohexyl-3-methyl-4-quinoxalin-6-ylpyrazol-5-yl)amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(Nc2c(-c3ccc4nccnc4c3)c(C)nn2C2CCCCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H27N5O3/c1-16-24(17-8-10-22-23(14-17)28-13-12-27-22)25(31(30-16)18-6-4-3-5-7-18)29-21-11-9-19(34-2)15-20(21)26(32)33/h8-15,18,29H,3-7H2,1-2H3,(H,32,33) |
| InChIKey | WHKXUARDLLUFHJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|