C25H16Cl2F4N2O3 — CID 52942080
(4Z)-2-(3,5-dichlorophenyl)-4-[[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylidene]-5-(trifluoromethyl)pyrazol-3-one (PubChem CID 52942080) has the molecular formula C25H16Cl2F4N2O3 and a molecular weight of 539.31 g/mol. Its IUPAC name is (4Z)-2-(3,5-dichlorophenyl)-4-[[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylidene]-5-(trifluoromethyl)pyrazol-3-one.
| Compound Name | (4Z)-2-(3,5-dichlorophenyl)-4-[[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylidene]-5-(trifluoromethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 52942080 |
| Molecular Formula | C25H16Cl2F4N2O3 |
| Molecular Weight | 539.31 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | (4Z)-2-(3,5-dichlorophenyl)-4-[[3-[(4-fluorophenyl)methoxy]-4-methoxyphenyl]methylidene]-5-(trifluoromethyl)pyrazol-3-one |
| SMILES | COc1ccc(/C=C2\C(=O)N(c3cc(Cl)cc(Cl)c3)N=C2C(F)(F)F)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H16Cl2F4N2O3/c1-35-21-7-4-15(9-22(21)36-13-14-2-5-18(28)6-3-14)8-20-23(25(29,30)31)32-33(24(20)34)19-11-16(26)10-17(27)12-19/h2-12H,13H2,1H3/b20-8- |
| InChIKey | SBTNEORCINBHSE-ZBKNUEDVSA-N |
| XLogP | 7.07 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.31 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|