C17H19F3N2O3 — CID 52944607
N-hydroxy-3-[6-oxo-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-2,3-dihydropyridin-5-yl]propanamide (PubChem CID 52944607) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is N-hydroxy-3-[6-oxo-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-2,3-dihydropyridin-5-yl]propanamide.
| Compound Name | N-hydroxy-3-[6-oxo-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-2,3-dihydropyridin-5-yl]propanamide |
|---|---|
| PubChem CID | 52944607 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-hydroxy-3-[6-oxo-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-2,3-dihydropyridin-5-yl]propanamide |
| SMILES | O=C(CCC1=CCCN(CCc2cccc(C(F)(F)F)c2)C1=O)NO |
| InChI | InChI=1S/C17H19F3N2O3/c18-17(19,20)14-5-1-3-12(11-14)8-10-22-9-2-4-13(16(22)24)6-7-15(23)21-25/h1,3-5,11,25H,2,6-10H2,(H,21,23) |
| InChIKey | SENBZOCNICIWQK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|