C23H31N3OS — CID 52948312
(4-cyclobutylpiperazin-1-yl)-[3-(piperidin-1-ylmethyl)-1-benzothiophen-5-yl]methanone (PubChem CID 52948312) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is (4-cyclobutylpiperazin-1-yl)-[3-(piperidin-1-ylmethyl)-1-benzothiophen-5-yl]methanone.
| Compound Name | (4-cyclobutylpiperazin-1-yl)-[3-(piperidin-1-ylmethyl)-1-benzothiophen-5-yl]methanone |
|---|---|
| PubChem CID | 52948312 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (4-cyclobutylpiperazin-1-yl)-[3-(piperidin-1-ylmethyl)-1-benzothiophen-5-yl]methanone |
| SMILES | O=C(c1ccc2scc(CN3CCCCC3)c2c1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C23H31N3OS/c27-23(26-13-11-25(12-14-26)20-5-4-6-20)18-7-8-22-21(15-18)19(17-28-22)16-24-9-2-1-3-10-24/h7-8,15,17,20H,1-6,9-14,16H2 |
| InChIKey | WCSJFPHTFPWKRA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |