C18H20FN3O — CID 52949798
6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 52949798) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 52949798 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(Nc1nc2cc[nH]c(=O)c2c2cc(F)ccc12)C(C)(C)C |
| InChI | InChI=1S/C18H20FN3O/c1-10(18(2,3)4)21-16-12-6-5-11(19)9-13(12)15-14(22-16)7-8-20-17(15)23/h5-10H,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | FWSWBGCMLCFSRN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|