C26H46O7 — CID 52950935
(3S,4R,5S,8S,10S,11S)-3,11-dihydroxy-5-methoxy-4,6,6,8,10-pentamethyl-11-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]-7-oxoundecanoic acid (PubChem CID 52950935) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is (3S,4R,5S,8S,10S,11S)-3,11-dihydroxy-5-methoxy-4,6,6,8,10-pentamethyl-11-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]-7-oxoundecanoic acid.
| Compound Name | (3S,4R,5S,8S,10S,11S)-3,11-dihydroxy-5-methoxy-4,6,6,8,10-pentamethyl-11-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]-7-oxoundecanoic acid |
|---|---|
| PubChem CID | 52950935 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (3S,4R,5S,8S,10S,11S)-3,11-dihydroxy-5-methoxy-4,6,6,8,10-pentamethyl-11-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]-7-oxoundecanoic acid |
| SMILES | CO[C@@H]([C@H](C)[C@@H](O)CC(=O)O)C(C)(C)C(=O)[C@@H](C)C[C@H](C)[C@H](O)[C@@]1(C)O[C@@H]1[C@@H](C)C=C(C)C |
| InChI | InChI=1S/C26H46O7/c1-14(2)11-17(5)23-26(9,33-23)22(31)16(4)12-15(3)21(30)25(7,8)24(32-10)18(6)19(27)13-20(28)29/h11,15-19,22-24,27,31H,12-13H2,1-10H3,(H,28,29)/t15-,16-,17-,18+,19-,22-,23+,24-,26+/m0/s1 |
| InChIKey | QQRFTCUQLLWQEO-AVPWRDOMSA-N |
| XLogP | 3.85 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|