C27H26F3N5O3S — CID 52951736
1-[3-[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 52951736) has the molecular formula C27H26F3N5O3S and a molecular weight of 557.60 g/mol. Its IUPAC name is 1-[3-[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 52951736 |
| Molecular Formula | C27H26F3N5O3S |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 1-[3-[5-(4-methylphenyl)-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(-c2cc(CCCNC(=O)Nc3cccc(C(F)(F)F)c3)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C27H26F3N5O3S/c1-18-7-9-19(10-8-18)25-17-22(34-35(25)23-11-13-24(14-12-23)39(31,37)38)6-3-15-32-26(36)33-21-5-2-4-20(16-21)27(28,29)30/h2,4-5,7-14,16-17H,3,6,15H2,1H3,(H2,31,37,38)(H2,32,33,36) |
| InChIKey | KPZWJSMDQMZGAZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|