C18H8Cl3NO2 — CID 52952988
2-(3,4,5-trichlorophenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 52952988) has the molecular formula C18H8Cl3NO2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(3,4,5-trichlorophenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 52952988 |
| Molecular Formula | C18H8Cl3NO2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H8Cl3NO2/c19-13-7-10(8-14(20)16(13)21)22-17(23)11-5-1-3-9-4-2-6-12(15(9)11)18(22)24/h1-8H |
| InChIKey | KVJQOJJVSPXGPN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|