C24H20ClFN2O2S — CID 5295375
2-[4-(2-chloro-6-fluorophenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 5295375) has the molecular formula C24H20ClFN2O2S and a molecular weight of 454.95 g/mol. Its IUPAC name is 2-[4-(2-chloro-6-fluorophenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[4-(2-chloro-6-fluorophenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 5295375 |
| Molecular Formula | C24H20ClFN2O2S |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-[4-(2-chloro-6-fluorophenyl)-2,5-dioxo-4,6,7,8-tetrahydro-3H-quinolin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N2C(=O)CC(c3c(F)cccc3Cl)C3=C2CCCC3=O)sc2c1CCCC2 |
| InChI | InChI=1S/C24H20ClFN2O2S/c25-16-6-3-7-17(26)22(16)14-11-21(30)28(18-8-4-9-19(29)23(14)18)24-15(12-27)13-5-1-2-10-20(13)31-24/h3,6-7,14H,1-2,4-5,8-11H2 |
| InChIKey | CKACDUQZGAJLSQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |