C15H13BrN4O3S — CID 52958697
(2E)-2-(5-bromo-1-ethyl-2-oxoindol-3-ylidene)-2-[(5-methyl-4H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetate (PubChem CID 52958697) has the molecular formula C15H13BrN4O3S and a molecular weight of 409.27 g/mol. Its IUPAC name is (2E)-2-(5-bromo-1-ethyl-2-oxoindol-3-ylidene)-2-[(5-methyl-4H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetate.
| Compound Name | (2E)-2-(5-bromo-1-ethyl-2-oxoindol-3-ylidene)-2-[(5-methyl-4H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 52958697 |
| Molecular Formula | C15H13BrN4O3S |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | (2E)-2-(5-bromo-1-ethyl-2-oxoindol-3-ylidene)-2-[(5-methyl-4H-1,2,4-triazol-4-ium-3-yl)sulfanyl]acetate |
| SMILES | CCN1C(=O)/C(=C(/SC2=NN=C(C)[NH2+]2)C(=O)[O-])c2cc(Br)ccc21 |
| InChI | InChI=1S/C15H13BrN4O3S/c1-3-20-10-5-4-8(16)6-9(10)11(13(20)21)12(14(22)23)24-15-17-7(2)18-19-15/h4-6H,3H2,1-2H3,(H,22,23)(H,17,18,19)/b12-11+ |
| InChIKey | MQGBPTCRFPGDEO-VAWYXSNFSA-N |
| XLogP | 0.28 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|