C22H28N6S — CID 52974860
N-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(triazolidin-4-ylsulfanyl)ethanamine (PubChem CID 52974860) has the molecular formula C22H28N6S and a molecular weight of 408.58 g/mol. Its IUPAC name is N-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(triazolidin-4-ylsulfanyl)ethanamine.
| Compound Name | N-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(triazolidin-4-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 52974860 |
| Molecular Formula | C22H28N6S |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[[3-(3-methylphenyl)-1-(4-methylphenyl)pyrazol-4-yl]methyl]-2-(triazolidin-4-ylsulfanyl)ethanamine |
| SMILES | Cc1ccc(-n2cc(CNCCSC3CNNN3)c(-c3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C22H28N6S/c1-16-6-8-20(9-7-16)28-15-19(13-23-10-11-29-21-14-24-27-25-21)22(26-28)18-5-3-4-17(2)12-18/h3-9,12,15,21,23-25,27H,10-11,13-14H2,1-2H3 |
| InChIKey | IYDRVSYWDCSNSD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|